C20H19ClF3N3 — CID 123929293
N-[(2-chlorophenyl)methyl]-2-ethyl-4-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]aniline (PubChem CID 123929293) has the molecular formula C20H19ClF3N3 and a molecular weight of 393.84 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-2-ethyl-4-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]aniline.
| Compound Name | N-[(2-chlorophenyl)methyl]-2-ethyl-4-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]aniline |
|---|---|
| PubChem CID | 123929293 |
| Molecular Formula | C20H19ClF3N3 |
| Molecular Weight | 393.84 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-2-ethyl-4-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]aniline |
| SMILES | CCc1cc(-c2cc(C(F)(F)F)nn2C)ccc1NCc1ccccc1Cl |
| InChI | InChI=1S/C20H19ClF3N3/c1-3-13-10-14(18-11-19(20(22,23)24)26-27(18)2)8-9-17(13)25-12-15-6-4-5-7-16(15)21/h4-11,25H,3,12H2,1-2H3 |
| InChIKey | XNNVJNUOGGVRND-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.84 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |