C22H26F3IN5O2- — CID 172954014
CID 172954014 (PubChem CID 172954014) has the molecular formula C22H26F3IN5O2- and a molecular weight of 576.38 g/mol.
| Compound Name | CID 172954014 |
|---|---|
| PubChem CID | 172954014 |
| Molecular Formula | C22H26F3IN5O2- |
| Molecular Weight | 576.38 g/mol |
| Exact Mass | 576.11 |
| IUPAC Name | — |
| SMILES | CCCC/C(=N\OCC1=C(C)C[I-]CC=C1n1nnn(C)c1=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H26F3IN5O2/c1-4-5-9-19(16-7-6-8-17(12-16)22(23,24)25)27-33-14-18-15(2)13-26-11-10-20(18)31-21(32)30(3)28-29-31/h6-8,10,12H,4-5,9,11,13-14H2,1-3H3/q-1/b27-19+ |
| InChIKey | VQOIYXLTYQNGDL-ZXVVBBHZSA-N |
| XLogP | 0.87 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.38 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|