C20H19F3N4O3 — CID 173235458
5-methoxy-2-methyl-4-[3-[[1-[3-(trifluoromethyl)phenyl]ethylideneamino]oxymethyl]phenyl]-1,2,4-triazol-3-one (PubChem CID 173235458) has the molecular formula C20H19F3N4O3 and a molecular weight of 420.39 g/mol. Its IUPAC name is 5-methoxy-2-methyl-4-[3-[[1-[3-(trifluoromethyl)phenyl]ethylideneamino]oxymethyl]phenyl]-1,2,4-triazol-3-one.
| Compound Name | 5-methoxy-2-methyl-4-[3-[[1-[3-(trifluoromethyl)phenyl]ethylideneamino]oxymethyl]phenyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 173235458 |
| Molecular Formula | C20H19F3N4O3 |
| Molecular Weight | 420.39 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 5-methoxy-2-methyl-4-[3-[[1-[3-(trifluoromethyl)phenyl]ethylideneamino]oxymethyl]phenyl]-1,2,4-triazol-3-one |
| SMILES | COc1nn(C)c(=O)n1-c1cccc(CON=C(C)c2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C20H19F3N4O3/c1-13(15-7-5-8-16(11-15)20(21,22)23)25-30-12-14-6-4-9-17(10-14)27-18(29-3)24-26(2)19(27)28/h4-11H,12H2,1-3H3 |
| InChIKey | WUBZJZFZOKOUGD-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 70.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.39 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|