C29H27F3N2O3 — CID 42796568
(Z)-1-[1,5-bis(3-methoxyphenyl)-2-methylpyrrol-3-yl]-N-[[3-(trifluoromethyl)phenyl]methoxy]ethanimine (PubChem CID 42796568) has the molecular formula C29H27F3N2O3 and a molecular weight of 508.54 g/mol. Its IUPAC name is (Z)-1-[1,5-bis(3-methoxyphenyl)-2-methylpyrrol-3-yl]-N-[[3-(trifluoromethyl)phenyl]methoxy]ethanimine.
| Compound Name | (Z)-1-[1,5-bis(3-methoxyphenyl)-2-methylpyrrol-3-yl]-N-[[3-(trifluoromethyl)phenyl]methoxy]ethanimine |
|---|---|
| PubChem CID | 42796568 |
| Molecular Formula | C29H27F3N2O3 |
| Molecular Weight | 508.54 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | (Z)-1-[1,5-bis(3-methoxyphenyl)-2-methylpyrrol-3-yl]-N-[[3-(trifluoromethyl)phenyl]methoxy]ethanimine |
| SMILES | COc1cccc(-c2cc(/C(C)=N\OCc3cccc(C(F)(F)F)c3)c(C)n2-c2cccc(OC)c2)c1 |
| InChI | InChI=1S/C29H27F3N2O3/c1-19(33-37-18-21-8-5-10-23(14-21)29(30,31)32)27-17-28(22-9-6-12-25(15-22)35-3)34(20(27)2)24-11-7-13-26(16-24)36-4/h5-17H,18H2,1-4H3/b33-19- |
| InChIKey | CFIJGAGBWVOJEV-APTWKGOFSA-N |
| XLogP | 7.43 |
| TPSA | 44.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.54 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|