C27H21F5N2O — CID 93116593
(E)-1-[1-(2-fluorophenyl)-5-(4-fluorophenyl)-2-methylpyrrol-3-yl]-N-[[3-(trifluoromethyl)phenyl]methoxy]ethanimine (PubChem CID 93116593) has the molecular formula C27H21F5N2O and a molecular weight of 484.47 g/mol. Its IUPAC name is (E)-1-[1-(2-fluorophenyl)-5-(4-fluorophenyl)-2-methylpyrrol-3-yl]-N-[[3-(trifluoromethyl)phenyl]methoxy]ethanimine.
| Compound Name | (E)-1-[1-(2-fluorophenyl)-5-(4-fluorophenyl)-2-methylpyrrol-3-yl]-N-[[3-(trifluoromethyl)phenyl]methoxy]ethanimine |
|---|---|
| PubChem CID | 93116593 |
| Molecular Formula | C27H21F5N2O |
| Molecular Weight | 484.47 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | (E)-1-[1-(2-fluorophenyl)-5-(4-fluorophenyl)-2-methylpyrrol-3-yl]-N-[[3-(trifluoromethyl)phenyl]methoxy]ethanimine |
| SMILES | C/C(=N\OCc1cccc(C(F)(F)F)c1)c1cc(-c2ccc(F)cc2)n(-c2ccccc2F)c1C |
| InChI | InChI=1S/C27H21F5N2O/c1-17(33-35-16-19-6-5-7-21(14-19)27(30,31)32)23-15-26(20-10-12-22(28)13-11-20)34(18(23)2)25-9-4-3-8-24(25)29/h3-15H,16H2,1-2H3/b33-17+ |
| InChIKey | SOTUBSIPGZAEDT-ATZGPIRCSA-N |
| XLogP | 7.69 |
| TPSA | 26.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.47 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|