C27H24ClFN2O2 — CID 42796614
(Z)-1-[1-(3-chlorophenyl)-5-(4-fluorophenyl)-2-methylpyrrol-3-yl]-N-[(4-methoxyphenyl)methoxy]ethanimine (PubChem CID 42796614) has the molecular formula C27H24ClFN2O2 and a molecular weight of 462.95 g/mol. Its IUPAC name is (Z)-1-[1-(3-chlorophenyl)-5-(4-fluorophenyl)-2-methylpyrrol-3-yl]-N-[(4-methoxyphenyl)methoxy]ethanimine.
| Compound Name | (Z)-1-[1-(3-chlorophenyl)-5-(4-fluorophenyl)-2-methylpyrrol-3-yl]-N-[(4-methoxyphenyl)methoxy]ethanimine |
|---|---|
| PubChem CID | 42796614 |
| Molecular Formula | C27H24ClFN2O2 |
| Molecular Weight | 462.95 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | (Z)-1-[1-(3-chlorophenyl)-5-(4-fluorophenyl)-2-methylpyrrol-3-yl]-N-[(4-methoxyphenyl)methoxy]ethanimine |
| SMILES | COc1ccc(CO/N=C(/C)c2cc(-c3ccc(F)cc3)n(-c3cccc(Cl)c3)c2C)cc1 |
| InChI | InChI=1S/C27H24ClFN2O2/c1-18(30-33-17-20-7-13-25(32-3)14-8-20)26-16-27(21-9-11-23(29)12-10-21)31(19(26)2)24-6-4-5-22(28)15-24/h4-16H,17H2,1-3H3/b30-18- |
| InChIKey | BIHMCYVOKJHFHY-YKQZZPSBSA-N |
| XLogP | 7.19 |
| TPSA | 35.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.95 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|