C28H24FN3O2 — CID 24718548
3-[[(Z)-1-[5-(4-fluorophenyl)-1-(4-methoxyphenyl)-2-methylpyrrol-3-yl]ethylideneamino]oxymethyl]benzonitrile (PubChem CID 24718548) has the molecular formula C28H24FN3O2 and a molecular weight of 453.52 g/mol. Its IUPAC name is 3-[[(Z)-1-[5-(4-fluorophenyl)-1-(4-methoxyphenyl)-2-methylpyrrol-3-yl]ethylideneamino]oxymethyl]benzonitrile.
| Compound Name | 3-[[(Z)-1-[5-(4-fluorophenyl)-1-(4-methoxyphenyl)-2-methylpyrrol-3-yl]ethylideneamino]oxymethyl]benzonitrile |
|---|---|
| PubChem CID | 24718548 |
| Molecular Formula | C28H24FN3O2 |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | 3-[[(Z)-1-[5-(4-fluorophenyl)-1-(4-methoxyphenyl)-2-methylpyrrol-3-yl]ethylideneamino]oxymethyl]benzonitrile |
| SMILES | COc1ccc(-n2c(-c3ccc(F)cc3)cc(/C(C)=N\OCc3cccc(C#N)c3)c2C)cc1 |
| InChI | InChI=1S/C28H24FN3O2/c1-19(31-34-18-22-6-4-5-21(15-22)17-30)27-16-28(23-7-9-24(29)10-8-23)32(20(27)2)25-11-13-26(33-3)14-12-25/h4-16H,18H2,1-3H3/b31-19- |
| InChIKey | OXAOMBSWCMIIAA-DXJNIWACSA-N |
| XLogP | 6.41 |
| TPSA | 59.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|