C29H30N2O3 — CID 93116580
(E)-1-[5-(3-methoxyphenyl)-1-(4-methoxyphenyl)-2-methylpyrrol-3-yl]-N-[(4-methylphenyl)methoxy]ethanimine (PubChem CID 93116580) has the molecular formula C29H30N2O3 and a molecular weight of 454.57 g/mol. Its IUPAC name is (E)-1-[5-(3-methoxyphenyl)-1-(4-methoxyphenyl)-2-methylpyrrol-3-yl]-N-[(4-methylphenyl)methoxy]ethanimine.
| Compound Name | (E)-1-[5-(3-methoxyphenyl)-1-(4-methoxyphenyl)-2-methylpyrrol-3-yl]-N-[(4-methylphenyl)methoxy]ethanimine |
|---|---|
| PubChem CID | 93116580 |
| Molecular Formula | C29H30N2O3 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | (E)-1-[5-(3-methoxyphenyl)-1-(4-methoxyphenyl)-2-methylpyrrol-3-yl]-N-[(4-methylphenyl)methoxy]ethanimine |
| SMILES | COc1ccc(-n2c(-c3cccc(OC)c3)cc(/C(C)=N/OCc3ccc(C)cc3)c2C)cc1 |
| InChI | InChI=1S/C29H30N2O3/c1-20-9-11-23(12-10-20)19-34-30-21(2)28-18-29(24-7-6-8-27(17-24)33-5)31(22(28)3)25-13-15-26(32-4)16-14-25/h6-18H,19H2,1-5H3/b30-21+ |
| InChIKey | RGRZBGDNPMXFIG-MWAVMZGNSA-N |
| XLogP | 6.72 |
| TPSA | 44.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|