C27H26N2O — CID 71958669
1-(2-methyl-1,5-diphenylpyrrol-3-yl)-N-[(4-methylphenyl)methoxy]ethanimine (PubChem CID 71958669) has the molecular formula C27H26N2O and a molecular weight of 394.52 g/mol. Its IUPAC name is 1-(2-methyl-1,5-diphenylpyrrol-3-yl)-N-[(4-methylphenyl)methoxy]ethanimine.
| Compound Name | 1-(2-methyl-1,5-diphenylpyrrol-3-yl)-N-[(4-methylphenyl)methoxy]ethanimine |
|---|---|
| PubChem CID | 71958669 |
| Molecular Formula | C27H26N2O |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 1-(2-methyl-1,5-diphenylpyrrol-3-yl)-N-[(4-methylphenyl)methoxy]ethanimine |
| SMILES | CC(=NOCc1ccc(C)cc1)c1cc(-c2ccccc2)n(-c2ccccc2)c1C |
| InChI | InChI=1S/C27H26N2O/c1-20-14-16-23(17-15-20)19-30-28-21(2)26-18-27(24-10-6-4-7-11-24)29(22(26)3)25-12-8-5-9-13-25/h4-18H,19H2,1-3H3 |
| InChIKey | IUHHCTAQQJTKJB-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 26.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|