C28H27FN2O2 — CID 93116643
(E)-1-[5-(4-fluorophenyl)-1-(4-methoxyphenyl)-2-methylpyrrol-3-yl]-N-[(3-methylphenyl)methoxy]ethanimine (PubChem CID 93116643) has the molecular formula C28H27FN2O2 and a molecular weight of 442.53 g/mol. Its IUPAC name is (E)-1-[5-(4-fluorophenyl)-1-(4-methoxyphenyl)-2-methylpyrrol-3-yl]-N-[(3-methylphenyl)methoxy]ethanimine.
| Compound Name | (E)-1-[5-(4-fluorophenyl)-1-(4-methoxyphenyl)-2-methylpyrrol-3-yl]-N-[(3-methylphenyl)methoxy]ethanimine |
|---|---|
| PubChem CID | 93116643 |
| Molecular Formula | C28H27FN2O2 |
| Molecular Weight | 442.53 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | (E)-1-[5-(4-fluorophenyl)-1-(4-methoxyphenyl)-2-methylpyrrol-3-yl]-N-[(3-methylphenyl)methoxy]ethanimine |
| SMILES | COc1ccc(-n2c(-c3ccc(F)cc3)cc(/C(C)=N/OCc3cccc(C)c3)c2C)cc1 |
| InChI | InChI=1S/C28H27FN2O2/c1-19-6-5-7-22(16-19)18-33-30-20(2)27-17-28(23-8-10-24(29)11-9-23)31(21(27)3)25-12-14-26(32-4)15-13-25/h5-17H,18H2,1-4H3/b30-20+ |
| InChIKey | GQUROSNYZSBDAY-TWKHWXDSSA-N |
| XLogP | 6.85 |
| TPSA | 35.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.53 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|