C23H23FN2O — CID 93116618
(E)-1-[5-(4-fluorophenyl)-2-methyl-1-(3-methylphenyl)pyrrol-3-yl]-N-prop-2-enoxyethanimine (PubChem CID 93116618) has the molecular formula C23H23FN2O and a molecular weight of 362.45 g/mol. Its IUPAC name is (E)-1-[5-(4-fluorophenyl)-2-methyl-1-(3-methylphenyl)pyrrol-3-yl]-N-prop-2-enoxyethanimine.
| Compound Name | (E)-1-[5-(4-fluorophenyl)-2-methyl-1-(3-methylphenyl)pyrrol-3-yl]-N-prop-2-enoxyethanimine |
|---|---|
| PubChem CID | 93116618 |
| Molecular Formula | C23H23FN2O |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | (E)-1-[5-(4-fluorophenyl)-2-methyl-1-(3-methylphenyl)pyrrol-3-yl]-N-prop-2-enoxyethanimine |
| SMILES | C=CCO/N=C(\C)c1cc(-c2ccc(F)cc2)n(-c2cccc(C)c2)c1C |
| InChI | InChI=1S/C23H23FN2O/c1-5-13-27-25-17(3)22-15-23(19-9-11-20(24)12-10-19)26(18(22)4)21-8-6-7-16(2)14-21/h5-12,14-15H,1,13H2,2-4H3/b25-17+ |
| InChIKey | JEBKOPQHSQLUAZ-KOEQRZSOSA-N |
| XLogP | 5.83 |
| TPSA | 26.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|