C26H21F3N2O — CID 93116599
(E)-1-[1,5-bis(4-fluorophenyl)-2-methylpyrrol-3-yl]-N-[(3-fluorophenyl)methoxy]ethanimine (PubChem CID 93116599) has the molecular formula C26H21F3N2O and a molecular weight of 434.46 g/mol. Its IUPAC name is (E)-1-[1,5-bis(4-fluorophenyl)-2-methylpyrrol-3-yl]-N-[(3-fluorophenyl)methoxy]ethanimine.
| Compound Name | (E)-1-[1,5-bis(4-fluorophenyl)-2-methylpyrrol-3-yl]-N-[(3-fluorophenyl)methoxy]ethanimine |
|---|---|
| PubChem CID | 93116599 |
| Molecular Formula | C26H21F3N2O |
| Molecular Weight | 434.46 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | (E)-1-[1,5-bis(4-fluorophenyl)-2-methylpyrrol-3-yl]-N-[(3-fluorophenyl)methoxy]ethanimine |
| SMILES | C/C(=N\OCc1cccc(F)c1)c1cc(-c2ccc(F)cc2)n(-c2ccc(F)cc2)c1C |
| InChI | InChI=1S/C26H21F3N2O/c1-17(30-32-16-19-4-3-5-23(29)14-19)25-15-26(20-6-8-21(27)9-7-20)31(18(25)2)24-12-10-22(28)11-13-24/h3-15H,16H2,1-2H3/b30-17+ |
| InChIKey | GKKGELWVQXBLCN-OCSSWDANSA-N |
| XLogP | 6.81 |
| TPSA | 26.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.46 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|