C28H26N2O4 — CID 71959665
N-(1,3-benzodioxol-5-ylmethoxy)-1-[5-(3-methoxyphenyl)-2-methyl-1-phenylpyrrol-3-yl]ethanimine (PubChem CID 71959665) has the molecular formula C28H26N2O4 and a molecular weight of 454.53 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethoxy)-1-[5-(3-methoxyphenyl)-2-methyl-1-phenylpyrrol-3-yl]ethanimine.
| Compound Name | N-(1,3-benzodioxol-5-ylmethoxy)-1-[5-(3-methoxyphenyl)-2-methyl-1-phenylpyrrol-3-yl]ethanimine |
|---|---|
| PubChem CID | 71959665 |
| Molecular Formula | C28H26N2O4 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethoxy)-1-[5-(3-methoxyphenyl)-2-methyl-1-phenylpyrrol-3-yl]ethanimine |
| SMILES | COc1cccc(-c2cc(C(C)=NOCc3ccc4c(c3)OCO4)c(C)n2-c2ccccc2)c1 |
| InChI | InChI=1S/C28H26N2O4/c1-19(29-34-17-21-12-13-27-28(14-21)33-18-32-27)25-16-26(22-8-7-11-24(15-22)31-3)30(20(25)2)23-9-5-4-6-10-23/h4-16H,17-18H2,1-3H3 |
| InChIKey | HRGFBKBAALVDKO-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 54.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|