C27H23ClN2O4 — CID 42785674
N-(1,3-benzodioxol-5-ylmethyl)-5-(4-chlorophenyl)-1-(3-methoxyphenyl)-2-methylpyrrole-3-carboxamide (PubChem CID 42785674) has the molecular formula C27H23ClN2O4 and a molecular weight of 474.94 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-5-(4-chlorophenyl)-1-(3-methoxyphenyl)-2-methylpyrrole-3-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-5-(4-chlorophenyl)-1-(3-methoxyphenyl)-2-methylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 42785674 |
| Molecular Formula | C27H23ClN2O4 |
| Molecular Weight | 474.94 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-5-(4-chlorophenyl)-1-(3-methoxyphenyl)-2-methylpyrrole-3-carboxamide |
| SMILES | COc1cccc(-n2c(-c3ccc(Cl)cc3)cc(C(=O)NCc3ccc4c(c3)OCO4)c2C)c1 |
| InChI | InChI=1S/C27H23ClN2O4/c1-17-23(27(31)29-15-18-6-11-25-26(12-18)34-16-33-25)14-24(19-7-9-20(28)10-8-19)30(17)21-4-3-5-22(13-21)32-2/h3-14H,15-16H2,1-2H3,(H,29,31) |
| InChIKey | UXOCMXLWKNFDFL-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.94 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|