C27H21F2N3O — CID 42796580
2-[[(Z)-1-[1-(2-fluorophenyl)-5-(4-fluorophenyl)-2-methylpyrrol-3-yl]ethylideneamino]oxymethyl]benzonitrile (PubChem CID 42796580) has the molecular formula C27H21F2N3O and a molecular weight of 441.48 g/mol. Its IUPAC name is 2-[[(Z)-1-[1-(2-fluorophenyl)-5-(4-fluorophenyl)-2-methylpyrrol-3-yl]ethylideneamino]oxymethyl]benzonitrile.
| Compound Name | 2-[[(Z)-1-[1-(2-fluorophenyl)-5-(4-fluorophenyl)-2-methylpyrrol-3-yl]ethylideneamino]oxymethyl]benzonitrile |
|---|---|
| PubChem CID | 42796580 |
| Molecular Formula | C27H21F2N3O |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 2-[[(Z)-1-[1-(2-fluorophenyl)-5-(4-fluorophenyl)-2-methylpyrrol-3-yl]ethylideneamino]oxymethyl]benzonitrile |
| SMILES | C/C(=N/OCc1ccccc1C#N)c1cc(-c2ccc(F)cc2)n(-c2ccccc2F)c1C |
| InChI | InChI=1S/C27H21F2N3O/c1-18(31-33-17-22-8-4-3-7-21(22)16-30)24-15-27(20-11-13-23(28)14-12-20)32(19(24)2)26-10-6-5-9-25(26)29/h3-15H,17H2,1-2H3/b31-18- |
| InChIKey | YBNQHZODCBDUHN-MNBJERMJSA-N |
| XLogP | 6.54 |
| TPSA | 50.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|