C20H19F3N4O5S — CID 173020034
5-methoxy-2-methyl-4-[2-[[1-[3-(trifluoromethylsulfonyl)phenyl]ethylideneamino]oxymethyl]phenyl]-1,2,4-triazol-3-one (PubChem CID 173020034) has the molecular formula C20H19F3N4O5S and a molecular weight of 484.46 g/mol. Its IUPAC name is 5-methoxy-2-methyl-4-[2-[[1-[3-(trifluoromethylsulfonyl)phenyl]ethylideneamino]oxymethyl]phenyl]-1,2,4-triazol-3-one.
| Compound Name | 5-methoxy-2-methyl-4-[2-[[1-[3-(trifluoromethylsulfonyl)phenyl]ethylideneamino]oxymethyl]phenyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 173020034 |
| Molecular Formula | C20H19F3N4O5S |
| Molecular Weight | 484.46 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | 5-methoxy-2-methyl-4-[2-[[1-[3-(trifluoromethylsulfonyl)phenyl]ethylideneamino]oxymethyl]phenyl]-1,2,4-triazol-3-one |
| SMILES | COc1nn(C)c(=O)n1-c1ccccc1CON=C(C)c1cccc(S(=O)(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C20H19F3N4O5S/c1-13(14-8-6-9-16(11-14)33(29,30)20(21,22)23)25-32-12-15-7-4-5-10-17(15)27-18(31-3)24-26(2)19(27)28/h4-11H,12H2,1-3H3 |
| InChIKey | DULPCJQWDMOCBP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 104.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.46 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|