C21H22FN5O5 — CID 10928374
methyl (1Z,2E)-2-(4-fluorophenyl)-2-methoxyimino-N-[[2-(3-methoxy-1-methyl-5-oxo-1,2,4-triazol-4-yl)phenyl]methoxy]ethanimidate (PubChem CID 10928374) has the molecular formula C21H22FN5O5 and a molecular weight of 443.44 g/mol. Its IUPAC name is methyl (1Z,2E)-2-(4-fluorophenyl)-2-methoxyimino-N-[[2-(3-methoxy-1-methyl-5-oxo-1,2,4-triazol-4-yl)phenyl]methoxy]ethanimidate.
| Compound Name | methyl (1Z,2E)-2-(4-fluorophenyl)-2-methoxyimino-N-[[2-(3-methoxy-1-methyl-5-oxo-1,2,4-triazol-4-yl)phenyl]methoxy]ethanimidate |
|---|---|
| PubChem CID | 10928374 |
| Molecular Formula | C21H22FN5O5 |
| Molecular Weight | 443.44 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | methyl (1Z,2E)-2-(4-fluorophenyl)-2-methoxyimino-N-[[2-(3-methoxy-1-methyl-5-oxo-1,2,4-triazol-4-yl)phenyl]methoxy]ethanimidate |
| SMILES | CO/N=C(C(=N/OCc1ccccc1-n1c(OC)nn(C)c1=O)/OC)\c1ccc(F)cc1 |
| InChI | InChI=1S/C21H22FN5O5/c1-26-21(28)27(20(23-26)30-3)17-8-6-5-7-15(17)13-32-25-19(29-2)18(24-31-4)14-9-11-16(22)12-10-14/h5-12H,13H2,1-4H3/b24-18+,25-19- |
| InChIKey | BHCFOPSIAYNAJW-UYMKXGBOSA-N |
| XLogP | 2.25 |
| TPSA | 101.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.44 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|