C18H16F3N5O2 — CID 154038493
1-methyl-4-[3-methyl-2-[[(Z)-[3-(trifluoromethyl)phenyl]methylideneamino]oxymethyl]phenyl]tetrazol-5-one (PubChem CID 154038493) has the molecular formula C18H16F3N5O2 and a molecular weight of 391.35 g/mol. Its IUPAC name is 1-methyl-4-[3-methyl-2-[[(Z)-[3-(trifluoromethyl)phenyl]methylideneamino]oxymethyl]phenyl]tetrazol-5-one.
| Compound Name | 1-methyl-4-[3-methyl-2-[[(Z)-[3-(trifluoromethyl)phenyl]methylideneamino]oxymethyl]phenyl]tetrazol-5-one |
|---|---|
| PubChem CID | 154038493 |
| Molecular Formula | C18H16F3N5O2 |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 1-methyl-4-[3-methyl-2-[[(Z)-[3-(trifluoromethyl)phenyl]methylideneamino]oxymethyl]phenyl]tetrazol-5-one |
| SMILES | Cc1cccc(-n2nnn(C)c2=O)c1CO/N=C\c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H16F3N5O2/c1-12-5-3-8-16(26-17(27)25(2)23-24-26)15(12)11-28-22-10-13-6-4-7-14(9-13)18(19,20)21/h3-10H,11H2,1-2H3/b22-10- |
| InChIKey | ADAMLIMGYJLZND-YVNNLAQVSA-N |
| XLogP | 2.84 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|