C24H24F5NO3 — CID 166811944
methyl (Z)-2-[2-[[(E)-1-[2,3-difluoro-5-(trifluoromethyl)phenyl]ethylideneamino]oxymethyl]-3-methylphenyl]hex-2-enoate (PubChem CID 166811944) has the molecular formula C24H24F5NO3 and a molecular weight of 469.45 g/mol. Its IUPAC name is methyl (Z)-2-[2-[[(E)-1-[2,3-difluoro-5-(trifluoromethyl)phenyl]ethylideneamino]oxymethyl]-3-methylphenyl]hex-2-enoate.
| Compound Name | methyl (Z)-2-[2-[[(E)-1-[2,3-difluoro-5-(trifluoromethyl)phenyl]ethylideneamino]oxymethyl]-3-methylphenyl]hex-2-enoate |
|---|---|
| PubChem CID | 166811944 |
| Molecular Formula | C24H24F5NO3 |
| Molecular Weight | 469.45 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | methyl (Z)-2-[2-[[(E)-1-[2,3-difluoro-5-(trifluoromethyl)phenyl]ethylideneamino]oxymethyl]-3-methylphenyl]hex-2-enoate |
| SMILES | CCC/C=C(\C(=O)OC)c1cccc(C)c1CO/N=C(\C)c1cc(C(F)(F)F)cc(F)c1F |
| InChI | InChI=1S/C24H24F5NO3/c1-5-6-9-18(23(31)32-4)17-10-7-8-14(2)20(17)13-33-30-15(3)19-11-16(24(27,28)29)12-21(25)22(19)26/h7-12H,5-6,13H2,1-4H3/b18-9-,30-15+ |
| InChIKey | UXFDLMDQGMKBEZ-GOBFFHPWSA-N |
| XLogP | 6.59 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.45 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|