C20H20BrFN2O4 — CID 157023853
methyl (2E)-2-[2-[[(E)-1-(3-bromo-2-fluorophenyl)ethylideneamino]oxymethyl]-3-methylphenyl]-2-methoxyiminoacetate (PubChem CID 157023853) has the molecular formula C20H20BrFN2O4 and a molecular weight of 451.29 g/mol. Its IUPAC name is methyl (2E)-2-[2-[[(E)-1-(3-bromo-2-fluorophenyl)ethylideneamino]oxymethyl]-3-methylphenyl]-2-methoxyiminoacetate.
| Compound Name | methyl (2E)-2-[2-[[(E)-1-(3-bromo-2-fluorophenyl)ethylideneamino]oxymethyl]-3-methylphenyl]-2-methoxyiminoacetate |
|---|---|
| PubChem CID | 157023853 |
| Molecular Formula | C20H20BrFN2O4 |
| Molecular Weight | 451.29 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | methyl (2E)-2-[2-[[(E)-1-(3-bromo-2-fluorophenyl)ethylideneamino]oxymethyl]-3-methylphenyl]-2-methoxyiminoacetate |
| SMILES | CO/N=C(/C(=O)OC)c1cccc(C)c1CO/N=C(\C)c1cccc(Br)c1F |
| InChI | InChI=1S/C20H20BrFN2O4/c1-12-7-5-9-15(19(24-27-4)20(25)26-3)16(12)11-28-23-13(2)14-8-6-10-17(21)18(14)22/h5-10H,11H2,1-4H3/b23-13+,24-19+ |
| InChIKey | ILEGUSWUEQRLDN-JUDCTDMSSA-N |
| XLogP | 4.36 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.29 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|