C19H19FN2O4 — CID 175357372
2-[2-[[(E)-1-(2-fluorophenyl)ethylideneamino]oxymethyl]-3-methylphenyl]-2-methoxyiminoacetic acid (PubChem CID 175357372) has the molecular formula C19H19FN2O4 and a molecular weight of 358.37 g/mol. Its IUPAC name is 2-[2-[[(E)-1-(2-fluorophenyl)ethylideneamino]oxymethyl]-3-methylphenyl]-2-methoxyiminoacetic acid.
| Compound Name | 2-[2-[[(E)-1-(2-fluorophenyl)ethylideneamino]oxymethyl]-3-methylphenyl]-2-methoxyiminoacetic acid |
|---|---|
| PubChem CID | 175357372 |
| Molecular Formula | C19H19FN2O4 |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 2-[2-[[(E)-1-(2-fluorophenyl)ethylideneamino]oxymethyl]-3-methylphenyl]-2-methoxyiminoacetic acid |
| SMILES | CON=C(C(=O)O)c1cccc(C)c1CO/N=C(\C)c1ccccc1F |
| InChI | InChI=1S/C19H19FN2O4/c1-12-7-6-9-15(18(19(23)24)22-25-3)16(12)11-26-21-13(2)14-8-4-5-10-17(14)20/h4-10H,11H2,1-3H3,(H,23,24)/b21-13+,22-18? |
| InChIKey | MLMRHJWMKPJSBM-CLROKWMRSA-N |
| XLogP | 3.51 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|