C18H22N4O4 — CID 170412367
methyl (2E)-2-methoxyimino-2-[3-methyl-2-[[(E)-1-(3-methylimidazol-4-yl)ethylideneamino]oxymethyl]phenyl]acetate (PubChem CID 170412367) has the molecular formula C18H22N4O4 and a molecular weight of 358.40 g/mol. Its IUPAC name is methyl (2E)-2-methoxyimino-2-[3-methyl-2-[[(E)-1-(3-methylimidazol-4-yl)ethylideneamino]oxymethyl]phenyl]acetate.
| Compound Name | methyl (2E)-2-methoxyimino-2-[3-methyl-2-[[(E)-1-(3-methylimidazol-4-yl)ethylideneamino]oxymethyl]phenyl]acetate |
|---|---|
| PubChem CID | 170412367 |
| Molecular Formula | C18H22N4O4 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | methyl (2E)-2-methoxyimino-2-[3-methyl-2-[[(E)-1-(3-methylimidazol-4-yl)ethylideneamino]oxymethyl]phenyl]acetate |
| SMILES | CO/N=C(/C(=O)OC)c1cccc(C)c1CO/N=C(\C)c1cncn1C |
| InChI | InChI=1S/C18H22N4O4/c1-12-7-6-8-14(17(21-25-5)18(23)24-4)15(12)10-26-20-13(2)16-9-19-11-22(16)3/h6-9,11H,10H2,1-5H3/b20-13+,21-17+ |
| InChIKey | DMVIXIUBZLFZNY-YHHVCGRHSA-N |
| XLogP | 2.19 |
| TPSA | 87.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|