C19H19F3N4O4 — CID 162729342
methyl (2E)-2-methoxyimino-2-[3-methyl-2-[[(E)-1-[6-(trifluoromethyl)pyrimidin-4-yl]ethylideneamino]oxymethyl]phenyl]acetate (PubChem CID 162729342) has the molecular formula C19H19F3N4O4 and a molecular weight of 424.38 g/mol. Its IUPAC name is methyl (2E)-2-methoxyimino-2-[3-methyl-2-[[(E)-1-[6-(trifluoromethyl)pyrimidin-4-yl]ethylideneamino]oxymethyl]phenyl]acetate.
| Compound Name | methyl (2E)-2-methoxyimino-2-[3-methyl-2-[[(E)-1-[6-(trifluoromethyl)pyrimidin-4-yl]ethylideneamino]oxymethyl]phenyl]acetate |
|---|---|
| PubChem CID | 162729342 |
| Molecular Formula | C19H19F3N4O4 |
| Molecular Weight | 424.38 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | methyl (2E)-2-methoxyimino-2-[3-methyl-2-[[(E)-1-[6-(trifluoromethyl)pyrimidin-4-yl]ethylideneamino]oxymethyl]phenyl]acetate |
| SMILES | CO/N=C(/C(=O)OC)c1cccc(C)c1CO/N=C(\C)c1cc(C(F)(F)F)ncn1 |
| InChI | InChI=1S/C19H19F3N4O4/c1-11-6-5-7-13(17(26-29-4)18(27)28-3)14(11)9-30-25-12(2)15-8-16(19(20,21)22)24-10-23-15/h5-8,10H,9H2,1-4H3/b25-12+,26-17+ |
| InChIKey | ZQUDUSPKWXTGJY-YFTOCEFPSA-N |
| XLogP | 3.27 |
| TPSA | 95.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.38 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|