C24H29NO3 — CID 166814486
methyl (Z)-2-[2-[[(E)-1-(4-ethylphenyl)ethylideneamino]oxymethyl]phenyl]hex-2-enoate (PubChem CID 166814486) has the molecular formula C24H29NO3 and a molecular weight of 379.50 g/mol. Its IUPAC name is methyl (Z)-2-[2-[[(E)-1-(4-ethylphenyl)ethylideneamino]oxymethyl]phenyl]hex-2-enoate.
| Compound Name | methyl (Z)-2-[2-[[(E)-1-(4-ethylphenyl)ethylideneamino]oxymethyl]phenyl]hex-2-enoate |
|---|---|
| PubChem CID | 166814486 |
| Molecular Formula | C24H29NO3 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | methyl (Z)-2-[2-[[(E)-1-(4-ethylphenyl)ethylideneamino]oxymethyl]phenyl]hex-2-enoate |
| SMILES | CCC/C=C(\C(=O)OC)c1ccccc1CO/N=C(\C)c1ccc(CC)cc1 |
| InChI | InChI=1S/C24H29NO3/c1-5-7-11-23(24(26)27-4)22-12-9-8-10-21(22)17-28-25-18(3)20-15-13-19(6-2)14-16-20/h8-16H,5-7,17H2,1-4H3/b23-11-,25-18+ |
| InChIKey | SKKNVEBTSXLVBT-RCRXNDKCSA-N |
| XLogP | 5.55 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|