C29H31NO6 — CID 123372954
methyl 3-methoxy-2-[2-[[2-methoxy-5-[C-methyl-N-(2-phenylethoxy)carbonimidoyl]phenoxy]methyl]phenyl]prop-2-enoate (PubChem CID 123372954) has the molecular formula C29H31NO6 and a molecular weight of 489.57 g/mol. Its IUPAC name is methyl 3-methoxy-2-[2-[[2-methoxy-5-[C-methyl-N-(2-phenylethoxy)carbonimidoyl]phenoxy]methyl]phenyl]prop-2-enoate.
| Compound Name | methyl 3-methoxy-2-[2-[[2-methoxy-5-[C-methyl-N-(2-phenylethoxy)carbonimidoyl]phenoxy]methyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 123372954 |
| Molecular Formula | C29H31NO6 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | methyl 3-methoxy-2-[2-[[2-methoxy-5-[C-methyl-N-(2-phenylethoxy)carbonimidoyl]phenoxy]methyl]phenyl]prop-2-enoate |
| SMILES | COC=C(C(=O)OC)c1ccccc1COc1cc(C(C)=NOCCc2ccccc2)ccc1OC |
| InChI | InChI=1S/C29H31NO6/c1-21(30-36-17-16-22-10-6-5-7-11-22)23-14-15-27(33-3)28(18-23)35-19-24-12-8-9-13-25(24)26(20-32-2)29(31)34-4/h5-15,18,20H,16-17,19H2,1-4H3 |
| InChIKey | FPZXNRBUBAFIFA-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 75.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|