C27H26FNO6 — CID 88531317
methyl (E)-2-[2-[[2-fluoro-6-methoxy-4-[(E)-phenylmethoxyiminomethyl]phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate (PubChem CID 88531317) has the molecular formula C27H26FNO6 and a molecular weight of 479.50 g/mol. Its IUPAC name is methyl (E)-2-[2-[[2-fluoro-6-methoxy-4-[(E)-phenylmethoxyiminomethyl]phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate.
| Compound Name | methyl (E)-2-[2-[[2-fluoro-6-methoxy-4-[(E)-phenylmethoxyiminomethyl]phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 88531317 |
| Molecular Formula | C27H26FNO6 |
| Molecular Weight | 479.50 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | methyl (E)-2-[2-[[2-fluoro-6-methoxy-4-[(E)-phenylmethoxyiminomethyl]phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate |
| SMILES | CO/C=C(/C(=O)OC)c1ccccc1COc1c(F)cc(/C=N/OCc2ccccc2)cc1OC |
| InChI | InChI=1S/C27H26FNO6/c1-31-18-23(27(30)33-3)22-12-8-7-11-21(22)17-34-26-24(28)13-20(14-25(26)32-2)15-29-35-16-19-9-5-4-6-10-19/h4-15,18H,16-17H2,1-3H3/b23-18+,29-15+ |
| InChIKey | AZHGFVRXPZZJMJ-LWVOQXOESA-N |
| XLogP | 5.12 |
| TPSA | 75.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.50 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|