C27H27NO4 — CID 173378443
methyl 2-[2-[[2-methyl-4-(phenylmethoxyiminomethyl)phenoxy]methyl]phenyl]but-2-enoate (PubChem CID 173378443) has the molecular formula C27H27NO4 and a molecular weight of 429.52 g/mol. Its IUPAC name is methyl 2-[2-[[2-methyl-4-(phenylmethoxyiminomethyl)phenoxy]methyl]phenyl]but-2-enoate.
| Compound Name | methyl 2-[2-[[2-methyl-4-(phenylmethoxyiminomethyl)phenoxy]methyl]phenyl]but-2-enoate |
|---|---|
| PubChem CID | 173378443 |
| Molecular Formula | C27H27NO4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | methyl 2-[2-[[2-methyl-4-(phenylmethoxyiminomethyl)phenoxy]methyl]phenyl]but-2-enoate |
| SMILES | CC=C(C(=O)OC)c1ccccc1COc1ccc(C=NOCc2ccccc2)cc1C |
| InChI | InChI=1S/C27H27NO4/c1-4-24(27(29)30-3)25-13-9-8-12-23(25)19-31-26-15-14-22(16-20(26)2)17-28-32-18-21-10-6-5-7-11-21/h4-17H,18-19H2,1-3H3 |
| InChIKey | PNFDIOIWCNEPBI-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|