C26H26N2O5 — CID 123341056
2-[2-[[2,5-dimethyl-4-(pyridin-4-ylmethoxyiminomethyl)phenoxy]methyl]phenyl]-3-methoxyprop-2-enoic acid (PubChem CID 123341056) has the molecular formula C26H26N2O5 and a molecular weight of 446.50 g/mol. Its IUPAC name is 2-[2-[[2,5-dimethyl-4-(pyridin-4-ylmethoxyiminomethyl)phenoxy]methyl]phenyl]-3-methoxyprop-2-enoic acid.
| Compound Name | 2-[2-[[2,5-dimethyl-4-(pyridin-4-ylmethoxyiminomethyl)phenoxy]methyl]phenyl]-3-methoxyprop-2-enoic acid |
|---|---|
| PubChem CID | 123341056 |
| Molecular Formula | C26H26N2O5 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 2-[2-[[2,5-dimethyl-4-(pyridin-4-ylmethoxyiminomethyl)phenoxy]methyl]phenyl]-3-methoxyprop-2-enoic acid |
| SMILES | COC=C(C(=O)O)c1ccccc1COc1cc(C)c(C=NOCc2ccncc2)cc1C |
| InChI | InChI=1S/C26H26N2O5/c1-18-13-25(19(2)12-22(18)14-28-33-15-20-8-10-27-11-9-20)32-16-21-6-4-5-7-23(21)24(17-31-3)26(29)30/h4-14,17H,15-16H2,1-3H3,(H,29,30) |
| InChIKey | LIUFAZQUDPGGAP-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 90.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|