C29H27NO3 — CID 6905782
(E)-1-[3,4-bis(phenylmethoxy)phenyl]-N-[(4-methylphenyl)methoxy]methanimine (PubChem CID 6905782) has the molecular formula C29H27NO3 and a molecular weight of 437.54 g/mol. Its IUPAC name is (E)-1-[3,4-bis(phenylmethoxy)phenyl]-N-[(4-methylphenyl)methoxy]methanimine.
| Compound Name | (E)-1-[3,4-bis(phenylmethoxy)phenyl]-N-[(4-methylphenyl)methoxy]methanimine |
|---|---|
| PubChem CID | 6905782 |
| Molecular Formula | C29H27NO3 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | (E)-1-[3,4-bis(phenylmethoxy)phenyl]-N-[(4-methylphenyl)methoxy]methanimine |
| SMILES | Cc1ccc(CO/N=C/c2ccc(OCc3ccccc3)c(OCc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C29H27NO3/c1-23-12-14-26(15-13-23)22-33-30-19-27-16-17-28(31-20-24-8-4-2-5-9-24)29(18-27)32-21-25-10-6-3-7-11-25/h2-19H,20-22H2,1H3/b30-19+ |
| InChIKey | HAOLRIXYPRMWKB-NDZAJKAJSA-N |
| XLogP | 6.70 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|