C26H29NO3 — CID 6906138
(E)-N-[(4-tert-butylphenyl)methoxy]-1-(4-methoxy-3-phenylmethoxyphenyl)methanimine (PubChem CID 6906138) has the molecular formula C26H29NO3 and a molecular weight of 403.52 g/mol. Its IUPAC name is (E)-N-[(4-tert-butylphenyl)methoxy]-1-(4-methoxy-3-phenylmethoxyphenyl)methanimine.
| Compound Name | (E)-N-[(4-tert-butylphenyl)methoxy]-1-(4-methoxy-3-phenylmethoxyphenyl)methanimine |
|---|---|
| PubChem CID | 6906138 |
| Molecular Formula | C26H29NO3 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | (E)-N-[(4-tert-butylphenyl)methoxy]-1-(4-methoxy-3-phenylmethoxyphenyl)methanimine |
| SMILES | COc1ccc(/C=N/OCc2ccc(C(C)(C)C)cc2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C26H29NO3/c1-26(2,3)23-13-10-21(11-14-23)19-30-27-17-22-12-15-24(28-4)25(16-22)29-18-20-8-6-5-7-9-20/h5-17H,18-19H2,1-4H3/b27-17+ |
| InChIKey | CGNUYJMINQIKHN-WPWMEQJKSA-N |
| XLogP | 6.12 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|