C30H30Cl2N2O5 — CID 54061780
methyl 2-[2-[[[1-[4-[2-(2,4-dichlorophenyl)ethyl]phenyl]-1-methoxyiminopropan-2-ylidene]amino]oxymethyl]phenyl]-3-methoxyprop-2-enoate (PubChem CID 54061780) has the molecular formula C30H30Cl2N2O5 and a molecular weight of 569.49 g/mol. Its IUPAC name is methyl 2-[2-[[[1-[4-[2-(2,4-dichlorophenyl)ethyl]phenyl]-1-methoxyiminopropan-2-ylidene]amino]oxymethyl]phenyl]-3-methoxyprop-2-enoate.
| Compound Name | methyl 2-[2-[[[1-[4-[2-(2,4-dichlorophenyl)ethyl]phenyl]-1-methoxyiminopropan-2-ylidene]amino]oxymethyl]phenyl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 54061780 |
| Molecular Formula | C30H30Cl2N2O5 |
| Molecular Weight | 569.49 g/mol |
| Exact Mass | 568.15 |
| IUPAC Name | methyl 2-[2-[[[1-[4-[2-(2,4-dichlorophenyl)ethyl]phenyl]-1-methoxyiminopropan-2-ylidene]amino]oxymethyl]phenyl]-3-methoxyprop-2-enoate |
| SMILES | COC=C(C(=O)OC)c1ccccc1CON=C(C)C(=NOC)c1ccc(CCc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C30H30Cl2N2O5/c1-20(33-39-18-24-7-5-6-8-26(24)27(19-36-2)30(35)37-3)29(34-38-4)23-13-10-21(11-14-23)9-12-22-15-16-25(31)17-28(22)32/h5-8,10-11,13-17,19H,9,12,18H2,1-4H3 |
| InChIKey | MAFSBIFLPHWKFC-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 78.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.49 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|