C29H29ClN2O6 — CID 57092395
methyl 2-[2-[[[3-[4-(4-chlorophenoxy)phenyl]-3-ethoxyiminoprop-1-en-2-yl]amino]oxymethyl]phenyl]-3-methoxyprop-2-enoate (PubChem CID 57092395) has the molecular formula C29H29ClN2O6 and a molecular weight of 537.01 g/mol. Its IUPAC name is methyl 2-[2-[[[3-[4-(4-chlorophenoxy)phenyl]-3-ethoxyiminoprop-1-en-2-yl]amino]oxymethyl]phenyl]-3-methoxyprop-2-enoate.
| Compound Name | methyl 2-[2-[[[3-[4-(4-chlorophenoxy)phenyl]-3-ethoxyiminoprop-1-en-2-yl]amino]oxymethyl]phenyl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 57092395 |
| Molecular Formula | C29H29ClN2O6 |
| Molecular Weight | 537.01 g/mol |
| Exact Mass | 536.17 |
| IUPAC Name | methyl 2-[2-[[[3-[4-(4-chlorophenoxy)phenyl]-3-ethoxyiminoprop-1-en-2-yl]amino]oxymethyl]phenyl]-3-methoxyprop-2-enoate |
| SMILES | C=C(NOCc1ccccc1C(=COC)C(=O)OC)C(=NOCC)c1ccc(Oc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C29H29ClN2O6/c1-5-36-32-28(21-10-14-24(15-11-21)38-25-16-12-23(30)13-17-25)20(2)31-37-18-22-8-6-7-9-26(22)27(19-34-3)29(33)35-4/h6-17,19,31H,2,5,18H2,1,3-4H3 |
| InChIKey | BQKILKOIQRZZCD-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 87.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.01 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|