C26H33N2O8P — CID 72611070
methyl 2-[2-[[[1-(4-diethoxyphosphorylphenyl)-1-methoxyiminopropan-2-ylidene]amino]oxymethyl]phenyl]-3-methoxyprop-2-enoate (PubChem CID 72611070) has the molecular formula C26H33N2O8P and a molecular weight of 532.53 g/mol. Its IUPAC name is methyl 2-[2-[[[1-(4-diethoxyphosphorylphenyl)-1-methoxyiminopropan-2-ylidene]amino]oxymethyl]phenyl]-3-methoxyprop-2-enoate.
| Compound Name | methyl 2-[2-[[[1-(4-diethoxyphosphorylphenyl)-1-methoxyiminopropan-2-ylidene]amino]oxymethyl]phenyl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 72611070 |
| Molecular Formula | C26H33N2O8P |
| Molecular Weight | 532.53 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | methyl 2-[2-[[[1-(4-diethoxyphosphorylphenyl)-1-methoxyiminopropan-2-ylidene]amino]oxymethyl]phenyl]-3-methoxyprop-2-enoate |
| SMILES | CCOP(=O)(OCC)c1ccc(C(=NOC)C(C)=NOCc2ccccc2C(=COC)C(=O)OC)cc1 |
| InChI | InChI=1S/C26H33N2O8P/c1-7-35-37(30,36-8-2)22-15-13-20(14-16-22)25(28-33-6)19(3)27-34-17-21-11-9-10-12-23(21)24(18-31-4)26(29)32-5/h9-16,18H,7-8,17H2,1-6H3 |
| InChIKey | SLIJKWHRFHCZSR-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 114.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.53 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|