C27H30Br2N2O6 — CID 59973020
methyl (E)-2-[2-[[(E)-[(1E)-1-[4-[(2,2-dibromo-1-methylcyclopropyl)methoxy]phenyl]-1-methoxyiminopropan-2-ylidene]amino]oxymethyl]phenyl]-3-methoxyprop-2-enoate (PubChem CID 59973020) has the molecular formula C27H30Br2N2O6 and a molecular weight of 638.35 g/mol. Its IUPAC name is methyl (E)-2-[2-[[(E)-[(1E)-1-[4-[(2,2-dibromo-1-methylcyclopropyl)methoxy]phenyl]-1-methoxyiminopropan-2-ylidene]amino]oxymethyl]phenyl]-3-methoxyprop-2-enoate.
| Compound Name | methyl (E)-2-[2-[[(E)-[(1E)-1-[4-[(2,2-dibromo-1-methylcyclopropyl)methoxy]phenyl]-1-methoxyiminopropan-2-ylidene]amino]oxymethyl]phenyl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 59973020 |
| Molecular Formula | C27H30Br2N2O6 |
| Molecular Weight | 638.35 g/mol |
| Exact Mass | 636.05 |
| IUPAC Name | methyl (E)-2-[2-[[(E)-[(1E)-1-[4-[(2,2-dibromo-1-methylcyclopropyl)methoxy]phenyl]-1-methoxyiminopropan-2-ylidene]amino]oxymethyl]phenyl]-3-methoxyprop-2-enoate |
| SMILES | CO/C=C(/C(=O)OC)c1ccccc1CO/N=C(C)/C(=N/OC)c1ccc(OCC2(C)CC2(Br)Br)cc1 |
| InChI | InChI=1S/C27H30Br2N2O6/c1-18(30-37-14-20-8-6-7-9-22(20)23(15-33-3)25(32)34-4)24(31-35-5)19-10-12-21(13-11-19)36-17-26(2)16-27(26,28)29/h6-13,15H,14,16-17H2,1-5H3/b23-15+,30-18+,31-24- |
| InChIKey | KIKOBNOQQYYCIZ-VLOBPLCISA-N |
| XLogP | 6.07 |
| TPSA | 87.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.35 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|