C26H31N3O6 — CID 54000712
methyl 2-[2-[[[1-(4-cyclopentyloxyphenyl)-1-methoxyiminopropan-2-ylidene]amino]oxymethyl]phenyl]-2-methoxyiminoacetate (PubChem CID 54000712) has the molecular formula C26H31N3O6 and a molecular weight of 481.55 g/mol. Its IUPAC name is methyl 2-[2-[[[1-(4-cyclopentyloxyphenyl)-1-methoxyiminopropan-2-ylidene]amino]oxymethyl]phenyl]-2-methoxyiminoacetate.
| Compound Name | methyl 2-[2-[[[1-(4-cyclopentyloxyphenyl)-1-methoxyiminopropan-2-ylidene]amino]oxymethyl]phenyl]-2-methoxyiminoacetate |
|---|---|
| PubChem CID | 54000712 |
| Molecular Formula | C26H31N3O6 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | methyl 2-[2-[[[1-(4-cyclopentyloxyphenyl)-1-methoxyiminopropan-2-ylidene]amino]oxymethyl]phenyl]-2-methoxyiminoacetate |
| SMILES | CON=C(C(C)=NOCc1ccccc1C(=NOC)C(=O)OC)c1ccc(OC2CCCC2)cc1 |
| InChI | InChI=1S/C26H31N3O6/c1-18(24(28-32-3)19-13-15-22(16-14-19)35-21-10-6-7-11-21)27-34-17-20-9-5-8-12-23(20)25(29-33-4)26(30)31-2/h5,8-9,12-16,21H,6-7,10-11,17H2,1-4H3 |
| InChIKey | KLJSMAUKTFFXQS-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 100.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|