C21H18F6N2O4 — CID 165361883
methyl 2-[2-[[1-[3,5-bis(trifluoromethyl)phenyl]ethylideneamino]oxymethyl]phenyl]-2-methoxyiminoacetate (PubChem CID 165361883) has the molecular formula C21H18F6N2O4 and a molecular weight of 476.37 g/mol. Its IUPAC name is methyl 2-[2-[[1-[3,5-bis(trifluoromethyl)phenyl]ethylideneamino]oxymethyl]phenyl]-2-methoxyiminoacetate.
| Compound Name | methyl 2-[2-[[1-[3,5-bis(trifluoromethyl)phenyl]ethylideneamino]oxymethyl]phenyl]-2-methoxyiminoacetate |
|---|---|
| PubChem CID | 165361883 |
| Molecular Formula | C21H18F6N2O4 |
| Molecular Weight | 476.37 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | methyl 2-[2-[[1-[3,5-bis(trifluoromethyl)phenyl]ethylideneamino]oxymethyl]phenyl]-2-methoxyiminoacetate |
| SMILES | CON=C(C(=O)OC)c1ccccc1CON=C(C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H18F6N2O4/c1-12(14-8-15(20(22,23)24)10-16(9-14)21(25,26)27)28-33-11-13-6-4-5-7-17(13)18(29-32-3)19(30)31-2/h4-10H,11H2,1-3H3 |
| InChIKey | UXIMWSOKPHFCHF-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.37 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|