C21H22ClN3O7 — CID 76755407
methyl 2-[2-[[1-[4-chloro-3-(methoxycarbonylamino)oxyphenyl]ethylideneamino]oxymethyl]phenyl]-2-methoxyiminoacetate (PubChem CID 76755407) has the molecular formula C21H22ClN3O7 and a molecular weight of 463.87 g/mol. Its IUPAC name is methyl 2-[2-[[1-[4-chloro-3-(methoxycarbonylamino)oxyphenyl]ethylideneamino]oxymethyl]phenyl]-2-methoxyiminoacetate.
| Compound Name | methyl 2-[2-[[1-[4-chloro-3-(methoxycarbonylamino)oxyphenyl]ethylideneamino]oxymethyl]phenyl]-2-methoxyiminoacetate |
|---|---|
| PubChem CID | 76755407 |
| Molecular Formula | C21H22ClN3O7 |
| Molecular Weight | 463.87 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | methyl 2-[2-[[1-[4-chloro-3-(methoxycarbonylamino)oxyphenyl]ethylideneamino]oxymethyl]phenyl]-2-methoxyiminoacetate |
| SMILES | CON=C(C(=O)OC)c1ccccc1CON=C(C)c1ccc(Cl)c(ONC(=O)OC)c1 |
| InChI | InChI=1S/C21H22ClN3O7/c1-13(14-9-10-17(22)18(11-14)32-25-21(27)29-3)23-31-12-15-7-5-6-8-16(15)19(24-30-4)20(26)28-2/h5-11H,12H2,1-4H3,(H,25,27) |
| InChIKey | XQJLHKOACBRTNN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 117.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.87 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|