C27H26Cl2IN3O8 — CID 172955065
methyl N-(5-acetyl-2-chlorophenoxy)carbamate;methyl N-[2-chloro-5-[(E)-N-[(2-iodophenyl)methoxy]-C-methylcarbonimidoyl]phenoxy]carbamate (PubChem CID 172955065) has the molecular formula C27H26Cl2IN3O8 and a molecular weight of 718.33 g/mol. Its IUPAC name is methyl N-(5-acetyl-2-chlorophenoxy)carbamate;methyl N-[2-chloro-5-[(E)-N-[(2-iodophenyl)methoxy]-C-methylcarbonimidoyl]phenoxy]carbamate.
| Compound Name | methyl N-(5-acetyl-2-chlorophenoxy)carbamate;methyl N-[2-chloro-5-[(E)-N-[(2-iodophenyl)methoxy]-C-methylcarbonimidoyl]phenoxy]carbamate |
|---|---|
| PubChem CID | 172955065 |
| Molecular Formula | C27H26Cl2IN3O8 |
| Molecular Weight | 718.33 g/mol |
| Exact Mass | 717.01 |
| IUPAC Name | methyl N-(5-acetyl-2-chlorophenoxy)carbamate;methyl N-[2-chloro-5-[(E)-N-[(2-iodophenyl)methoxy]-C-methylcarbonimidoyl]phenoxy]carbamate |
| SMILES | COC(=O)NOc1cc(/C(C)=N/OCc2ccccc2I)ccc1Cl.COC(=O)NOc1cc(C(C)=O)ccc1Cl |
| InChI | InChI=1S/C17H16ClIN2O4.C10H10ClNO4/c1-11(20-24-10-13-5-3-4-6-15(13)19)12-7-8-14(18)16(9-12)25-21-17(22)23-2;1-6(13)7-3-4-8(11)9(5-7)16-12-10(14)15-2/h3-9H,10H2,1-2H3,(H,21,22);3-5H,1-2H3,(H,12,14)/b20-11+; |
| InChIKey | AYIXAPFSQMWZRF-DOELHFPHSA-N |
| XLogP | 6.73 |
| TPSA | 133.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.33 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|