C19H18F4N2O4 — CID 76755369
methyl N-[5-[N-[[2-fluoro-3-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]-2-methylphenoxy]carbamate (PubChem CID 76755369) has the molecular formula C19H18F4N2O4 and a molecular weight of 414.36 g/mol. Its IUPAC name is methyl N-[5-[N-[[2-fluoro-3-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]-2-methylphenoxy]carbamate.
| Compound Name | methyl N-[5-[N-[[2-fluoro-3-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]-2-methylphenoxy]carbamate |
|---|---|
| PubChem CID | 76755369 |
| Molecular Formula | C19H18F4N2O4 |
| Molecular Weight | 414.36 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | methyl N-[5-[N-[[2-fluoro-3-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]-2-methylphenoxy]carbamate |
| SMILES | COC(=O)NOc1cc(C(C)=NOCc2cccc(C(F)(F)F)c2F)ccc1C |
| InChI | InChI=1S/C19H18F4N2O4/c1-11-7-8-13(9-16(11)29-25-18(26)27-3)12(2)24-28-10-14-5-4-6-15(17(14)20)19(21,22)23/h4-9H,10H2,1-3H3,(H,25,26) |
| InChIKey | IRUQMQWSBHIVIJ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.36 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|