C17H15F4NO4 — CID 88567618
5-[(E)-N-[[2-fluoro-3-(trifluoromethoxy)phenyl]methoxy]-C-methylcarbonimidoyl]-2-methoxyphenol (PubChem CID 88567618) has the molecular formula C17H15F4NO4 and a molecular weight of 373.30 g/mol. Its IUPAC name is 5-[(E)-N-[[2-fluoro-3-(trifluoromethoxy)phenyl]methoxy]-C-methylcarbonimidoyl]-2-methoxyphenol.
| Compound Name | 5-[(E)-N-[[2-fluoro-3-(trifluoromethoxy)phenyl]methoxy]-C-methylcarbonimidoyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 88567618 |
| Molecular Formula | C17H15F4NO4 |
| Molecular Weight | 373.30 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | 5-[(E)-N-[[2-fluoro-3-(trifluoromethoxy)phenyl]methoxy]-C-methylcarbonimidoyl]-2-methoxyphenol |
| SMILES | COc1ccc(/C(C)=N/OCc2cccc(OC(F)(F)F)c2F)cc1O |
| InChI | InChI=1S/C17H15F4NO4/c1-10(11-6-7-14(24-2)13(23)8-11)22-25-9-12-4-3-5-15(16(12)18)26-17(19,20)21/h3-8,23H,9H2,1-2H3/b22-10+ |
| InChIKey | DKXGHHSPEJZLPN-LSHDLFTRSA-N |
| XLogP | 4.38 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.30 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|