C18H19ClN2O5 — CID 76755408
methyl N-[2-chloro-5-[N-[(2-methoxyphenyl)methoxy]-C-methylcarbonimidoyl]phenoxy]carbamate (PubChem CID 76755408) has the molecular formula C18H19ClN2O5 and a molecular weight of 378.81 g/mol. Its IUPAC name is methyl N-[2-chloro-5-[N-[(2-methoxyphenyl)methoxy]-C-methylcarbonimidoyl]phenoxy]carbamate.
| Compound Name | methyl N-[2-chloro-5-[N-[(2-methoxyphenyl)methoxy]-C-methylcarbonimidoyl]phenoxy]carbamate |
|---|---|
| PubChem CID | 76755408 |
| Molecular Formula | C18H19ClN2O5 |
| Molecular Weight | 378.81 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | methyl N-[2-chloro-5-[N-[(2-methoxyphenyl)methoxy]-C-methylcarbonimidoyl]phenoxy]carbamate |
| SMILES | COC(=O)NOc1cc(C(C)=NOCc2ccccc2OC)ccc1Cl |
| InChI | InChI=1S/C18H19ClN2O5/c1-12(20-25-11-14-6-4-5-7-16(14)23-2)13-8-9-15(19)17(10-13)26-21-18(22)24-3/h4-10H,11H2,1-3H3,(H,21,22) |
| InChIKey | BYPKREVBTOLTOC-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.81 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|