C18H15ClF4N2O4 — CID 58308806
methyl N-[2-chloro-5-[(E)-N-[[2-fluoro-6-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]phenoxy]carbamate (PubChem CID 58308806) has the molecular formula C18H15ClF4N2O4 and a molecular weight of 434.77 g/mol. Its IUPAC name is methyl N-[2-chloro-5-[(E)-N-[[2-fluoro-6-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]phenoxy]carbamate.
| Compound Name | methyl N-[2-chloro-5-[(E)-N-[[2-fluoro-6-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]phenoxy]carbamate |
|---|---|
| PubChem CID | 58308806 |
| Molecular Formula | C18H15ClF4N2O4 |
| Molecular Weight | 434.77 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | methyl N-[2-chloro-5-[(E)-N-[[2-fluoro-6-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]phenoxy]carbamate |
| SMILES | COC(=O)NOc1cc(/C(C)=N/OCc2c(F)cccc2C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C18H15ClF4N2O4/c1-10(11-6-7-14(19)16(8-11)29-25-17(26)27-2)24-28-9-12-13(18(21,22)23)4-3-5-15(12)20/h3-8H,9H2,1-2H3,(H,25,26)/b24-10+ |
| InChIKey | RRPSTHMITNVWEU-YSURURNPSA-N |
| XLogP | 5.09 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.77 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|