C23H26Cl2N2O8 — CID 157292901
tert-butyl N-(5-acetyl-2-chlorophenoxy)carbamate;methyl N-(5-acetyl-2-chlorophenoxy)carbamate (PubChem CID 157292901) has the molecular formula C23H26Cl2N2O8 and a molecular weight of 529.37 g/mol. Its IUPAC name is tert-butyl N-(5-acetyl-2-chlorophenoxy)carbamate;methyl N-(5-acetyl-2-chlorophenoxy)carbamate.
| Compound Name | tert-butyl N-(5-acetyl-2-chlorophenoxy)carbamate;methyl N-(5-acetyl-2-chlorophenoxy)carbamate |
|---|---|
| PubChem CID | 157292901 |
| Molecular Formula | C23H26Cl2N2O8 |
| Molecular Weight | 529.37 g/mol |
| Exact Mass | 528.11 |
| IUPAC Name | tert-butyl N-(5-acetyl-2-chlorophenoxy)carbamate;methyl N-(5-acetyl-2-chlorophenoxy)carbamate |
| SMILES | CC(=O)c1ccc(Cl)c(ONC(=O)OC(C)(C)C)c1.COC(=O)NOc1cc(C(C)=O)ccc1Cl |
| InChI | InChI=1S/C13H16ClNO4.C10H10ClNO4/c1-8(16)9-5-6-10(14)11(7-9)19-15-12(17)18-13(2,3)4;1-6(13)7-3-4-8(11)9(5-7)16-12-10(14)15-2/h5-7H,1-4H3,(H,15,17);3-5H,1-2H3,(H,12,14) |
| InChIKey | BAZWRYKBCWEFIH-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.37 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|