C14H18ClNO3 — CID 175282842
(5-acetyl-2-chlorophenyl)methyl N-tert-butylcarbamate (PubChem CID 175282842) has the molecular formula C14H18ClNO3 and a molecular weight of 283.75 g/mol. Its IUPAC name is (5-acetyl-2-chlorophenyl)methyl N-tert-butylcarbamate.
| Compound Name | (5-acetyl-2-chlorophenyl)methyl N-tert-butylcarbamate |
|---|---|
| PubChem CID | 175282842 |
| Molecular Formula | C14H18ClNO3 |
| Molecular Weight | 283.75 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | (5-acetyl-2-chlorophenyl)methyl N-tert-butylcarbamate |
| SMILES | CC(=O)c1ccc(Cl)c(COC(=O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C14H18ClNO3/c1-9(17)10-5-6-12(15)11(7-10)8-19-13(18)16-14(2,3)4/h5-7H,8H2,1-4H3,(H,16,18) |
| InChIKey | RFSDSVKOOAECCO-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.75 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |