C17H17ClFN3O4 — CID 90848648
methyl N-[2-chloro-5-[1-[[6-(fluoromethyl)-2-pyridinyl]methoxyamino]ethenyl]phenoxy]carbamate (PubChem CID 90848648) has the molecular formula C17H17ClFN3O4 and a molecular weight of 381.79 g/mol. Its IUPAC name is methyl N-[2-chloro-5-[1-[[6-(fluoromethyl)-2-pyridinyl]methoxyamino]ethenyl]phenoxy]carbamate.
| Compound Name | methyl N-[2-chloro-5-[1-[[6-(fluoromethyl)-2-pyridinyl]methoxyamino]ethenyl]phenoxy]carbamate |
|---|---|
| PubChem CID | 90848648 |
| Molecular Formula | C17H17ClFN3O4 |
| Molecular Weight | 381.79 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | methyl N-[2-chloro-5-[1-[[6-(fluoromethyl)-2-pyridinyl]methoxyamino]ethenyl]phenoxy]carbamate |
| SMILES | C=C(NOCc1cccc(CF)n1)c1ccc(Cl)c(ONC(=O)OC)c1 |
| InChI | InChI=1S/C17H17ClFN3O4/c1-11(21-25-10-14-5-3-4-13(9-19)20-14)12-6-7-15(18)16(8-12)26-22-17(23)24-2/h3-8,21H,1,9-10H2,2H3,(H,22,23) |
| InChIKey | MSQFYVOSMCCENB-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.79 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|