C26H29ClN2O3 — CID 91544738
1-[4-chloro-3-(3,4-diethoxy-2-methylphenyl)phenyl]-N-[(6-methyl-2-pyridinyl)methoxy]ethenamine (PubChem CID 91544738) has the molecular formula C26H29ClN2O3 and a molecular weight of 452.98 g/mol. Its IUPAC name is 1-[4-chloro-3-(3,4-diethoxy-2-methylphenyl)phenyl]-N-[(6-methyl-2-pyridinyl)methoxy]ethenamine.
| Compound Name | 1-[4-chloro-3-(3,4-diethoxy-2-methylphenyl)phenyl]-N-[(6-methyl-2-pyridinyl)methoxy]ethenamine |
|---|---|
| PubChem CID | 91544738 |
| Molecular Formula | C26H29ClN2O3 |
| Molecular Weight | 452.98 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | 1-[4-chloro-3-(3,4-diethoxy-2-methylphenyl)phenyl]-N-[(6-methyl-2-pyridinyl)methoxy]ethenamine |
| SMILES | C=C(NOCc1cccc(C)n1)c1ccc(Cl)c(-c2ccc(OCC)c(OCC)c2C)c1 |
| InChI | InChI=1S/C26H29ClN2O3/c1-6-30-25-14-12-22(18(4)26(25)31-7-2)23-15-20(11-13-24(23)27)19(5)29-32-16-21-10-8-9-17(3)28-21/h8-15,29H,5-7,16H2,1-4H3 |
| InChIKey | IMZLNXJLDXDTQY-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.98 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|