C22H24F3NO4 — CID 142494403
methoxymethane;methyl 2-[2-[[(E)-1-[3-(trifluoromethyl)phenyl]ethylideneamino]oxymethyl]phenyl]prop-2-enoate (PubChem CID 142494403) has the molecular formula C22H24F3NO4 and a molecular weight of 423.43 g/mol. Its IUPAC name is methoxymethane;methyl 2-[2-[[(E)-1-[3-(trifluoromethyl)phenyl]ethylideneamino]oxymethyl]phenyl]prop-2-enoate.
| Compound Name | methoxymethane;methyl 2-[2-[[(E)-1-[3-(trifluoromethyl)phenyl]ethylideneamino]oxymethyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 142494403 |
| Molecular Formula | C22H24F3NO4 |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | methoxymethane;methyl 2-[2-[[(E)-1-[3-(trifluoromethyl)phenyl]ethylideneamino]oxymethyl]phenyl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)c1ccccc1CO/N=C(\C)c1cccc(C(F)(F)F)c1.COC |
| InChI | InChI=1S/C20H18F3NO3.C2H6O/c1-13(19(25)26-3)18-10-5-4-7-16(18)12-27-24-14(2)15-8-6-9-17(11-15)20(21,22)23;1-3-2/h4-11H,1,12H2,2-3H3;1-2H3/b24-14+; |
| InChIKey | DZLZENPZQGUNHJ-SXMBIPSUSA-N |
| XLogP | 5.09 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|