C21H18F6N2O5 — CID 25022864
methyl (2E)-2-[2-[[(Z)-[[3,5-bis(trifluoromethyl)phenyl]-methoxymethylidene]amino]oxymethyl]phenyl]-2-methoxyiminoacetate (PubChem CID 25022864) has the molecular formula C21H18F6N2O5 and a molecular weight of 492.37 g/mol. Its IUPAC name is methyl (2E)-2-[2-[[(Z)-[[3,5-bis(trifluoromethyl)phenyl]-methoxymethylidene]amino]oxymethyl]phenyl]-2-methoxyiminoacetate.
| Compound Name | methyl (2E)-2-[2-[[(Z)-[[3,5-bis(trifluoromethyl)phenyl]-methoxymethylidene]amino]oxymethyl]phenyl]-2-methoxyiminoacetate |
|---|---|
| PubChem CID | 25022864 |
| Molecular Formula | C21H18F6N2O5 |
| Molecular Weight | 492.37 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | methyl (2E)-2-[2-[[(Z)-[[3,5-bis(trifluoromethyl)phenyl]-methoxymethylidene]amino]oxymethyl]phenyl]-2-methoxyiminoacetate |
| SMILES | CO/N=C(/C(=O)OC)c1ccccc1CO/N=C(\OC)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H18F6N2O5/c1-31-18(13-8-14(20(22,23)24)10-15(9-13)21(25,26)27)29-34-11-12-6-4-5-7-16(12)17(28-33-3)19(30)32-2/h4-10H,11H2,1-3H3/b28-17+,29-18- |
| InChIKey | FZCYINUHWDYNQD-UOJDGNAJSA-N |
| XLogP | 4.77 |
| TPSA | 78.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.37 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|