C28H29ClN4O5 — CID 57173841
3-[[3-[4-(4-chlorophenoxy)phenyl]-3-ethoxyiminoprop-1-en-2-yl]amino]oxy-2-(methoxyamino)-N-methyl-N-phenylprop-2-enamide (PubChem CID 57173841) has the molecular formula C28H29ClN4O5 and a molecular weight of 537.02 g/mol. Its IUPAC name is 3-[[3-[4-(4-chlorophenoxy)phenyl]-3-ethoxyiminoprop-1-en-2-yl]amino]oxy-2-(methoxyamino)-N-methyl-N-phenylprop-2-enamide.
| Compound Name | 3-[[3-[4-(4-chlorophenoxy)phenyl]-3-ethoxyiminoprop-1-en-2-yl]amino]oxy-2-(methoxyamino)-N-methyl-N-phenylprop-2-enamide |
|---|---|
| PubChem CID | 57173841 |
| Molecular Formula | C28H29ClN4O5 |
| Molecular Weight | 537.02 g/mol |
| Exact Mass | 536.18 |
| IUPAC Name | 3-[[3-[4-(4-chlorophenoxy)phenyl]-3-ethoxyiminoprop-1-en-2-yl]amino]oxy-2-(methoxyamino)-N-methyl-N-phenylprop-2-enamide |
| SMILES | C=C(NOC=C(NOC)C(=O)N(C)c1ccccc1)C(=NOCC)c1ccc(Oc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C28H29ClN4O5/c1-5-36-32-27(21-11-15-24(16-12-21)38-25-17-13-22(29)14-18-25)20(2)30-37-19-26(31-35-4)28(34)33(3)23-9-7-6-8-10-23/h6-19,30-31H,2,5H2,1,3-4H3 |
| InChIKey | SSUNLAFAZHWZLF-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.02 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|