C18H27F3O — CID 142809248
2-methylhexane;1-[3-(trifluoromethyl)phenyl]butan-1-one (PubChem CID 142809248) has the molecular formula C18H27F3O and a molecular weight of 316.41 g/mol. Its IUPAC name is 2-methylhexane;1-[3-(trifluoromethyl)phenyl]butan-1-one.
| Compound Name | 2-methylhexane;1-[3-(trifluoromethyl)phenyl]butan-1-one |
|---|---|
| PubChem CID | 142809248 |
| Molecular Formula | C18H27F3O |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | 2-methylhexane;1-[3-(trifluoromethyl)phenyl]butan-1-one |
| SMILES | CCCC(=O)c1cccc(C(F)(F)F)c1.CCCCC(C)C |
| InChI | InChI=1S/C11H11F3O.C7H16/c1-2-4-10(15)8-5-3-6-9(7-8)11(12,13)14;1-4-5-6-7(2)3/h3,5-7H,2,4H2,1H3;7H,4-6H2,1-3H3 |
| InChIKey | MZNOPSHKHFYNOE-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |